C15H11ClN4OS — CID 50878957
2-N-(5-chloro-1,3-benzoxazol-2-yl)-6-methyl-1,3-benzothiazole-2,4-diamine (PubChem CID 50878957) has the molecular formula C15H11ClN4OS and a molecular weight of 330.80 g/mol. Its IUPAC name is 2-N-(5-chloro-1,3-benzoxazol-2-yl)-6-methyl-1,3-benzothiazole-2,4-diamine.
| Compound Name | 2-N-(5-chloro-1,3-benzoxazol-2-yl)-6-methyl-1,3-benzothiazole-2,4-diamine |
|---|---|
| PubChem CID | 50878957 |
| Molecular Formula | C15H11ClN4OS |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-N-(5-chloro-1,3-benzoxazol-2-yl)-6-methyl-1,3-benzothiazole-2,4-diamine |
| SMILES | Cc1cc(N)c2nc(Nc3nc4cc(Cl)ccc4o3)sc2c1 |
| InChI | InChI=1S/C15H11ClN4OS/c1-7-4-9(17)13-12(5-7)22-15(19-13)20-14-18-10-6-8(16)2-3-11(10)21-14/h2-6H,17H2,1H3,(H,18,19,20) |
| InChIKey | OBKYGVGVGNBWIU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|