C18H17N3OS — CID 50879002
N-(1,3-benzothiazol-2-yl)-5-tert-butyl-1,3-benzoxazol-2-amine (PubChem CID 50879002) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-tert-butyl-1,3-benzoxazol-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-tert-butyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 50879002 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-tert-butyl-1,3-benzoxazol-2-amine |
| SMILES | CC(C)(C)c1ccc2oc(Nc3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C18H17N3OS/c1-18(2,3)11-8-9-14-13(10-11)19-16(22-14)21-17-20-12-6-4-5-7-15(12)23-17/h4-10H,1-3H3,(H,19,20,21) |
| InChIKey | FVEIKBSTSHWFAX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |