C21H20N2O2S — CID 23833458
N-(1,3-benzothiazol-2-yl)-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide (PubChem CID 23833458) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 23833458 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide |
| SMILES | CC(C)(C)c1ccc2occ(CC(=O)Nc3nc4ccccc4s3)c2c1 |
| InChI | InChI=1S/C21H20N2O2S/c1-21(2,3)14-8-9-17-15(11-14)13(12-25-17)10-19(24)23-20-22-16-6-4-5-7-18(16)26-20/h4-9,11-12H,10H2,1-3H3,(H,22,23,24) |
| InChIKey | HLMXUFHYEQAPED-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |