C28H30N2O4S — CID 18861301
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide (PubChem CID 18861301) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18861301 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-tert-butyl-1-benzofuran-3-yl)acetamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=O)Cc2coc3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C28H30N2O4S/c1-28(2,3)22-10-15-26-25(17-22)21(19-34-26)16-27(31)29-23-11-13-24(14-12-23)35(32,33)30(4)18-20-8-6-5-7-9-20/h5-15,17,19H,16,18H2,1-4H3,(H,29,31) |
| InChIKey | TWKOAKBITUERDA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |