C24H30N2O3 — CID 23833451
2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]acetamide (PubChem CID 23833451) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]acetamide.
| Compound Name | 2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23833451 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]acetamide |
| SMILES | CCN(CCO)c1ccc(NC(=O)Cc2coc3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-5-26(12-13-27)20-9-7-19(8-10-20)25-23(28)14-17-16-29-22-11-6-18(15-21(17)22)24(2,3)4/h6-11,15-16,27H,5,12-14H2,1-4H3,(H,25,28) |
| InChIKey | JOIYGZATTLXSKZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|