C21H19ClF3NO2 — CID 18861285
2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 18861285) has the molecular formula C21H19ClF3NO2 and a molecular weight of 409.84 g/mol. Its IUPAC name is 2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18861285 |
| Molecular Formula | C21H19ClF3NO2 |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-(5-tert-butyl-1-benzofuran-3-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)(C)c1ccc2occ(CC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C21H19ClF3NO2/c1-20(2,3)13-4-7-18-15(9-13)12(11-28-18)8-19(27)26-14-5-6-17(22)16(10-14)21(23,24)25/h4-7,9-11H,8H2,1-3H3,(H,26,27) |
| InChIKey | QYRONOKVYHTMEC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |