C16H12N2OS — CID 141408571
N-(1-benzofuran-2-yl)-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 141408571) has the molecular formula C16H12N2OS and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(1-benzofuran-2-yl)-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(1-benzofuran-2-yl)-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 141408571 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-(1-benzofuran-2-yl)-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(Nc3cc4ccccc4o3)nc12 |
| InChI | InChI=1S/C16H12N2OS/c1-10-5-4-8-13-15(10)18-16(20-13)17-14-9-11-6-2-3-7-12(11)19-14/h2-9H,1H3,(H,17,18) |
| InChIKey | BKWRGIBKHPSADY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |