C14H10ClIN2S — CID 107607244
N-(2-chloro-4-iodophenyl)-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 107607244) has the molecular formula C14H10ClIN2S and a molecular weight of 400.67 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-chloro-4-iodophenyl)-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 107607244 |
| Molecular Formula | C14H10ClIN2S |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(Nc3ccc(I)cc3Cl)nc12 |
| InChI | InChI=1S/C14H10ClIN2S/c1-8-3-2-4-12-13(8)18-14(19-12)17-11-6-5-9(16)7-10(11)15/h2-7H,1H3,(H,17,18) |
| InChIKey | JRZDTIMMWRXJGR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|