C14H9Cl3N2S — CID 79146236
4-methyl-N-(2,4,6-trichlorophenyl)-1,3-benzothiazol-2-amine (PubChem CID 79146236) has the molecular formula C14H9Cl3N2S and a molecular weight of 343.67 g/mol. Its IUPAC name is 4-methyl-N-(2,4,6-trichlorophenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-methyl-N-(2,4,6-trichlorophenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79146236 |
| Molecular Formula | C14H9Cl3N2S |
| Molecular Weight | 343.67 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 4-methyl-N-(2,4,6-trichlorophenyl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(Nc3c(Cl)cc(Cl)cc3Cl)nc12 |
| InChI | InChI=1S/C14H9Cl3N2S/c1-7-3-2-4-11-12(7)18-14(20-11)19-13-9(16)5-8(15)6-10(13)17/h2-6H,1H3,(H,18,19) |
| InChIKey | DZMRXIUNHPWGGY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |