C11H18N4 — CID 158806320
2-ethyl-1H-imidazole;2-ethyl-5-methyl-1H-imidazole (PubChem CID 158806320) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-ethyl-1H-imidazole;2-ethyl-5-methyl-1H-imidazole.
| Compound Name | 2-ethyl-1H-imidazole;2-ethyl-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 158806320 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-ethyl-1H-imidazole;2-ethyl-5-methyl-1H-imidazole |
| SMILES | CCc1ncc(C)[nH]1.CCc1ncc[nH]1 |
| InChI | InChI=1S/C6H10N2.C5H8N2/c1-3-6-7-4-5(2)8-6;1-2-5-6-3-4-7-5/h4H,3H2,1-2H3,(H,7,8);3-4H,2H2,1H3,(H,6,7) |
| InChIKey | IUCTYTMZBTYOQA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |