About 2-ethyl-1H-imidazole;methyl(diphenyl)borane
2-ethyl-1H-imidazole;methyl(diphenyl)borane (PubChem CID 15753724) has the molecular formula C18H21BN2
and a molecular weight of 276.19 g/mol. Its IUPAC name is 2-ethyl-1H-imidazole;methyl(diphenyl)borane.
Molecular Properties
| Compound Name | 2-ethyl-1H-imidazole;methyl(diphenyl)borane |
| PubChem CID | 15753724 |
| Molecular Formula | C18H21BN2 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-ethyl-1H-imidazole;methyl(diphenyl)borane |
| SMILES | CB(c1ccccc1)c1ccccc1.CCc1ncc[nH]1 |
| InChI | InChI=1S/C13H13B.C5H8N2/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-5-6-3-4-7-5/h2-11H,1H3;3-4H,2H2,1H3,(H,6,7) |
| InChIKey | LTXDQEWNRPFZOA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1H-imidazole;methyl(diphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1H-imidazole;methyl(diphenyl)borane?
The IUPAC name of 2-ethyl-1H-imidazole;methyl(diphenyl)borane (CID 15753724) is 2-ethyl-1H-imidazole;methyl(diphenyl)borane.
What is the SMILES notation for 2-ethyl-1H-imidazole;methyl(diphenyl)borane?
The canonical SMILES for 2-ethyl-1H-imidazole;methyl(diphenyl)borane is CB(c1ccccc1)c1ccccc1.CCc1ncc[nH]1.
What is the InChIKey of 2-ethyl-1H-imidazole;methyl(diphenyl)borane?
The InChIKey is LTXDQEWNRPFZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13B.C5H8N2/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-5-6-3-4-7-5/h2-11H,1H3;3-4H,2H2,1H3,(H,6,7).
What are the key properties of 2-ethyl-1H-imidazole;methyl(diphenyl)borane?
2-ethyl-1H-imidazole;methyl(diphenyl)borane has a molecular weight of 276.19 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1H-imidazole;methyl(diphenyl)borane is sourced from PubChem (CID 15753724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).