About 2-ethyl-1H-imidazole;hexafluoroantimony(1-)
2-ethyl-1H-imidazole;hexafluoroantimony(1-) (PubChem CID 175050777) has the molecular formula C5H8F6N2Sb-
and a molecular weight of 331.88 g/mol. Its IUPAC name is 2-ethyl-1H-imidazole;hexafluoroantimony(1-).
Molecular Properties
| Compound Name | 2-ethyl-1H-imidazole;hexafluoroantimony(1-) |
| PubChem CID | 175050777 |
| Molecular Formula | C5H8F6N2Sb- |
| Molecular Weight | 331.88 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 2-ethyl-1H-imidazole;hexafluoroantimony(1-) |
| SMILES | CCc1ncc[nH]1.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C5H8N2.6FH.Sb/c1-2-5-6-3-4-7-5;;;;;;;/h3-4H,2H2,1H3,(H,6,7);6*1H;/q;;;;;;;+5/p-6 |
| InChIKey | ZJMFSOZDXYJXTM-UHFFFAOYSA-H |
| XLogP | 3.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.88 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1H-imidazole;hexafluoroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1H-imidazole;hexafluoroantimony(1-)?
The IUPAC name of 2-ethyl-1H-imidazole;hexafluoroantimony(1-) (CID 175050777) is 2-ethyl-1H-imidazole;hexafluoroantimony(1-).
What is the SMILES notation for 2-ethyl-1H-imidazole;hexafluoroantimony(1-)?
The canonical SMILES for 2-ethyl-1H-imidazole;hexafluoroantimony(1-) is CCc1ncc[nH]1.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of 2-ethyl-1H-imidazole;hexafluoroantimony(1-)?
The InChIKey is ZJMFSOZDXYJXTM-UHFFFAOYSA-H. The full InChI is InChI=1S/C5H8N2.6FH.Sb/c1-2-5-6-3-4-7-5;;;;;;;/h3-4H,2H2,1H3,(H,6,7);6*1H;/q;;;;;;;+5/p-6.
What are the key properties of 2-ethyl-1H-imidazole;hexafluoroantimony(1-)?
2-ethyl-1H-imidazole;hexafluoroantimony(1-) has a molecular weight of 331.88 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1H-imidazole;hexafluoroantimony(1-) is sourced from PubChem (CID 175050777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).