About 2-propyl-1H-imidazole tetrafluoroborate
2-propyl-1H-imidazole tetrafluoroborate (PubChem CID 174826414) has the molecular formula C6H10BF4N2-
and a molecular weight of 196.96 g/mol. Its IUPAC name is 2-propyl-1H-imidazole tetrafluoroborate.
Molecular Properties
| Compound Name | 2-propyl-1H-imidazole tetrafluoroborate |
| PubChem CID | 174826414 |
| Molecular Formula | C6H10BF4N2- |
| Molecular Weight | 196.96 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-propyl-1H-imidazole tetrafluoroborate |
| SMILES | CCCc1ncc[nH]1.F[B-](F)(F)F |
| InChI | InChI=1S/C6H10N2.BF4/c1-2-3-6-7-4-5-8-6;2-1(3,4)5/h4-5H,2-3H2,1H3,(H,7,8);/q;-1 |
| InChIKey | DIBPRTCBUZPTIY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-1H-imidazole tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1H-imidazole tetrafluoroborate?
The IUPAC name of 2-propyl-1H-imidazole tetrafluoroborate (CID 174826414) is 2-propyl-1H-imidazole tetrafluoroborate.
What is the SMILES notation for 2-propyl-1H-imidazole tetrafluoroborate?
The canonical SMILES for 2-propyl-1H-imidazole tetrafluoroborate is CCCc1ncc[nH]1.F[B-](F)(F)F.
What is the InChIKey of 2-propyl-1H-imidazole tetrafluoroborate?
The InChIKey is DIBPRTCBUZPTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.BF4/c1-2-3-6-7-4-5-8-6;2-1(3,4)5/h4-5H,2-3H2,1H3,(H,7,8);/q;-1.
What are the key properties of 2-propyl-1H-imidazole tetrafluoroborate?
2-propyl-1H-imidazole tetrafluoroborate has a molecular weight of 196.96 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1H-imidazole tetrafluoroborate is sourced from PubChem (CID 174826414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).