C16H27N5 — CID 140833512
N,N-bis[3-(1H-imidazol-2-yl)propyl]butan-1-amine (PubChem CID 140833512) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is N,N-bis[3-(1H-imidazol-2-yl)propyl]butan-1-amine.
| Compound Name | N,N-bis[3-(1H-imidazol-2-yl)propyl]butan-1-amine |
|---|---|
| PubChem CID | 140833512 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | N,N-bis[3-(1H-imidazol-2-yl)propyl]butan-1-amine |
| SMILES | CCCCN(CCCc1ncc[nH]1)CCCc1ncc[nH]1 |
| InChI | InChI=1S/C16H27N5/c1-2-3-12-21(13-4-6-15-17-8-9-18-15)14-5-7-16-19-10-11-20-16/h8-11H,2-7,12-14H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JERSZZWYUGJCGF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |