About acetonitrile;2-benzyl-1H-imidazole
acetonitrile;2-benzyl-1H-imidazole (PubChem CID 23033706) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is acetonitrile;2-benzyl-1H-imidazole.
Molecular Properties
| Compound Name | acetonitrile;2-benzyl-1H-imidazole |
| PubChem CID | 23033706 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | acetonitrile;2-benzyl-1H-imidazole |
| SMILES | CC#N.c1ccc(Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C10H10N2.C2H3N/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;1-2-3/h1-7H,8H2,(H,11,12);1H3 |
| InChIKey | JLQBEFNVPQYKNP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;2-benzyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-benzyl-1H-imidazole?
The IUPAC name of acetonitrile;2-benzyl-1H-imidazole (CID 23033706) is acetonitrile;2-benzyl-1H-imidazole.
What is the SMILES notation for acetonitrile;2-benzyl-1H-imidazole?
The canonical SMILES for acetonitrile;2-benzyl-1H-imidazole is CC#N.c1ccc(Cc2ncc[nH]2)cc1.
What is the InChIKey of acetonitrile;2-benzyl-1H-imidazole?
The InChIKey is JLQBEFNVPQYKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C2H3N/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;1-2-3/h1-7H,8H2,(H,11,12);1H3.
What are the key properties of acetonitrile;2-benzyl-1H-imidazole?
acetonitrile;2-benzyl-1H-imidazole has a molecular weight of 199.26 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-benzyl-1H-imidazole is sourced from PubChem (CID 23033706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).