C14H16N2O4 — CID 68635581
benzene-1,3-dicarboxylic acid;2-ethyl-5-methyl-1H-imidazole (PubChem CID 68635581) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;2-ethyl-5-methyl-1H-imidazole.
| Compound Name | benzene-1,3-dicarboxylic acid;2-ethyl-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 68635581 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;2-ethyl-5-methyl-1H-imidazole |
| SMILES | CCc1ncc(C)[nH]1.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O4.C6H10N2/c9-7(10)5-2-1-3-6(4-5)8(11)12;1-3-6-7-4-5(2)8-6/h1-4H,(H,9,10)(H,11,12);4H,3H2,1-2H3,(H,7,8) |
| InChIKey | WVSOGYLGSKPECN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |