C15H20N2O2 — CID 160958615
2-ethyl-5-methyl-1H-imidazole;2-(phenoxymethyl)oxirane (PubChem CID 160958615) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-ethyl-5-methyl-1H-imidazole;2-(phenoxymethyl)oxirane.
| Compound Name | 2-ethyl-5-methyl-1H-imidazole;2-(phenoxymethyl)oxirane |
|---|---|
| PubChem CID | 160958615 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-ethyl-5-methyl-1H-imidazole;2-(phenoxymethyl)oxirane |
| SMILES | CCc1ncc(C)[nH]1.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C9H10O2.C6H10N2/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-3-6-7-4-5(2)8-6/h1-5,9H,6-7H2;4H,3H2,1-2H3,(H,7,8) |
| InChIKey | SWSKZUQXAJMCIR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|