C19H22N2 — CID 19000532
2-[3-(2,3-dimethylphenyl)propyl]-4-methyl-1H-benzimidazole (PubChem CID 19000532) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylphenyl)propyl]-4-methyl-1H-benzimidazole.
| Compound Name | 2-[3-(2,3-dimethylphenyl)propyl]-4-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 19000532 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-[3-(2,3-dimethylphenyl)propyl]-4-methyl-1H-benzimidazole |
| SMILES | Cc1cccc(CCCc2nc3c(C)cccc3[nH]2)c1C |
| InChI | InChI=1S/C19H22N2/c1-13-7-4-9-16(15(13)3)10-6-12-18-20-17-11-5-8-14(2)19(17)21-18/h4-5,7-9,11H,6,10,12H2,1-3H3,(H,20,21) |
| InChIKey | VSEZHEGUCGHRBP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |