C45H45ClSi — CID 88962705
tris(3-benzyl-2,6-dimethylphenyl)-chlorosilane (PubChem CID 88962705) has the molecular formula C45H45ClSi and a molecular weight of 649.39 g/mol. Its IUPAC name is tris(3-benzyl-2,6-dimethylphenyl)-chlorosilane.
| Compound Name | tris(3-benzyl-2,6-dimethylphenyl)-chlorosilane |
|---|---|
| PubChem CID | 88962705 |
| Molecular Formula | C45H45ClSi |
| Molecular Weight | 649.39 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | tris(3-benzyl-2,6-dimethylphenyl)-chlorosilane |
| SMILES | Cc1ccc(Cc2ccccc2)c(C)c1[Si](Cl)(c1c(C)ccc(Cc2ccccc2)c1C)c1c(C)ccc(Cc2ccccc2)c1C |
| InChI | InChI=1S/C45H45ClSi/c1-31-22-25-40(28-37-16-10-7-11-17-37)34(4)43(31)47(46,44-32(2)23-26-41(35(44)5)29-38-18-12-8-13-19-38)45-33(3)24-27-42(36(45)6)30-39-20-14-9-15-21-39/h7-27H,28-30H2,1-6H3 |
| InChIKey | NLFIEFJJCGJTGF-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.39 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|