C15H18ClN — CID 21115446
(4-benzyl-2,3-dimethylphenyl)azanium chloride (PubChem CID 21115446) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is (4-benzyl-2,3-dimethylphenyl)azanium chloride.
| Compound Name | (4-benzyl-2,3-dimethylphenyl)azanium chloride |
|---|---|
| PubChem CID | 21115446 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (4-benzyl-2,3-dimethylphenyl)azanium chloride |
| SMILES | Cc1c([NH3+])ccc(Cc2ccccc2)c1C.[Cl-] |
| InChI | InChI=1S/C15H17N.ClH/c1-11-12(2)15(16)9-8-14(11)10-13-6-4-3-5-7-13;/h3-9H,10,16H2,1-2H3;1H |
| InChIKey | VQYRAWQPARFGQP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |