C17H17N — CID 162399358
1-(2-benzylphenyl)-2,3-dihydropyrrole (PubChem CID 162399358) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(2-benzylphenyl)-2,3-dihydropyrrole.
| Compound Name | 1-(2-benzylphenyl)-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 162399358 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(2-benzylphenyl)-2,3-dihydropyrrole |
| SMILES | C1=CN(c2ccccc2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H17N/c1-2-8-15(9-3-1)14-16-10-4-5-11-17(16)18-12-6-7-13-18/h1-6,8-12H,7,13-14H2 |
| InChIKey | PHGIGNZKMDLZAO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |