C78H102O6 — CID 10920282
1,2,3,4,5,6-hexakis[2-[4-(2-methoxypropan-2-yl)phenyl]ethyl]benzene (PubChem CID 10920282) has the molecular formula C78H102O6 and a molecular weight of 1135.67 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis[2-[4-(2-methoxypropan-2-yl)phenyl]ethyl]benzene.
| Compound Name | 1,2,3,4,5,6-hexakis[2-[4-(2-methoxypropan-2-yl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 10920282 |
| Molecular Formula | C78H102O6 |
| Molecular Weight | 1135.67 g/mol |
| Exact Mass | 1134.77 |
| IUPAC Name | 1,2,3,4,5,6-hexakis[2-[4-(2-methoxypropan-2-yl)phenyl]ethyl]benzene |
| SMILES | COC(C)(C)c1ccc(CCc2c(CCc3ccc(C(C)(C)OC)cc3)c(CCc3ccc(C(C)(C)OC)cc3)c(CCc3ccc(C(C)(C)OC)cc3)c(CCc3ccc(C(C)(C)OC)cc3)c2CCc2ccc(C(C)(C)OC)cc2)cc1 |
| InChI | InChI=1S/C78H102O6/c1-73(2,79-13)61-37-19-55(20-38-61)31-49-67-68(50-32-56-21-39-62(40-22-56)74(3,4)80-14)70(52-34-58-25-43-64(44-26-58)76(7,8)82-16)72(54-36-60-29-47-66(48-30-60)78(11,12)84-18)71(53-35-59-27-45-65(46-28-59)77(9,10)83-17)69(67)51-33-57-23-41-63(42-24-57)75(5,6)81-15/h19-30,37-48H,31-36,49-54H2,1-18H3 |
| InChIKey | OAPKAADZGXFMEA-UHFFFAOYSA-N |
| XLogP | 17.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1135.67 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |