C9H7Br2F3O — CID 107140564
1-bromo-2-(3-bromo-4-fluorophenyl)-1,1-difluoropropan-2-ol (PubChem CID 107140564) has the molecular formula C9H7Br2F3O and a molecular weight of 347.96 g/mol. Its IUPAC name is 1-bromo-2-(3-bromo-4-fluorophenyl)-1,1-difluoropropan-2-ol.
| Compound Name | 1-bromo-2-(3-bromo-4-fluorophenyl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 107140564 |
| Molecular Formula | C9H7Br2F3O |
| Molecular Weight | 347.96 g/mol |
| Exact Mass | 345.88 |
| IUPAC Name | 1-bromo-2-(3-bromo-4-fluorophenyl)-1,1-difluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(F)c(Br)c1)C(F)(F)Br |
| InChI | InChI=1S/C9H7Br2F3O/c1-8(15,9(11,13)14)5-2-3-7(12)6(10)4-5/h2-4,15H,1H3 |
| InChIKey | VOUXAAGPTBWLOU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|