C21H14BrF3O — CID 59226930
1-(3-bromo-4-fluorophenyl)-1,1-bis(4-fluorophenyl)propan-2-one (PubChem CID 59226930) has the molecular formula C21H14BrF3O and a molecular weight of 419.24 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-1,1-bis(4-fluorophenyl)propan-2-one.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-1,1-bis(4-fluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 59226930 |
| Molecular Formula | C21H14BrF3O |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-1,1-bis(4-fluorophenyl)propan-2-one |
| SMILES | CC(=O)C(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C21H14BrF3O/c1-13(26)21(14-2-7-17(23)8-3-14,15-4-9-18(24)10-5-15)16-6-11-20(25)19(22)12-16/h2-12H,1H3 |
| InChIKey | ARUKTONPORMPQL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|