C12H14BrF — CID 89044661
2-bromo-4-(2,3-dimethylbut-3-en-2-yl)-1-fluorobenzene (PubChem CID 89044661) has the molecular formula C12H14BrF and a molecular weight of 257.15 g/mol. Its IUPAC name is 2-bromo-4-(2,3-dimethylbut-3-en-2-yl)-1-fluorobenzene.
| Compound Name | 2-bromo-4-(2,3-dimethylbut-3-en-2-yl)-1-fluorobenzene |
|---|---|
| PubChem CID | 89044661 |
| Molecular Formula | C12H14BrF |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-bromo-4-(2,3-dimethylbut-3-en-2-yl)-1-fluorobenzene |
| SMILES | C=C(C)C(C)(C)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H14BrF/c1-8(2)12(3,4)9-5-6-11(14)10(13)7-9/h5-7H,1H2,2-4H3 |
| InChIKey | CRUQNLQAFYNYNQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|