C12H16F3NO — CID 55181159
3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 55181159) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 55181159 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | Cc1cc(C)cc(C(O)(C(C)N)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO/c1-7-4-8(2)6-10(5-7)11(17,9(3)16)12(13,14)15/h4-6,9,17H,16H2,1-3H3 |
| InChIKey | BDMBOPFGMUCATQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |