C14H15F3N2O — CID 81224082
3-amino-1,1,1-trifluoro-2-(2-methylquinolin-6-yl)butan-2-ol (PubChem CID 81224082) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(2-methylquinolin-6-yl)butan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-(2-methylquinolin-6-yl)butan-2-ol |
|---|---|
| PubChem CID | 81224082 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(2-methylquinolin-6-yl)butan-2-ol |
| SMILES | Cc1ccc2cc(C(O)(C(C)N)C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C14H15F3N2O/c1-8-3-4-10-7-11(5-6-12(10)19-8)13(20,9(2)18)14(15,16)17/h3-7,9,20H,18H2,1-2H3 |
| InChIKey | XYQZGYFPESHYFO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |