C19H20F6 — CID 142196366
4-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene (PubChem CID 142196366) has the molecular formula C19H20F6 and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 142196366 |
| Molecular Formula | C19H20F6 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
| SMILES | CC1=CC=C(C(c2ccc(C)c(C)c2)(C(F)(F)F)C(F)(F)F)CC1C |
| InChI | InChI=1S/C19H20F6/c1-11-5-7-15(9-13(11)3)17(18(20,21)22,19(23,24)25)16-8-6-12(2)14(4)10-16/h5-9,14H,10H2,1-4H3 |
| InChIKey | SVCXSHGWHBPOES-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |