C19H14ClF2NO2S — CID 3266947
N-[(2-chloro-3,6-difluorophenyl)methyl]-4-phenylbenzenesulfonamide (PubChem CID 3266947) has the molecular formula C19H14ClF2NO2S and a molecular weight of 393.84 g/mol. Its IUPAC name is N-[(2-chloro-3,6-difluorophenyl)methyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[(2-chloro-3,6-difluorophenyl)methyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 3266947 |
| Molecular Formula | C19H14ClF2NO2S |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-[(2-chloro-3,6-difluorophenyl)methyl]-4-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(NCc1c(F)ccc(F)c1Cl)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14ClF2NO2S/c20-19-16(17(21)10-11-18(19)22)12-23-26(24,25)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-11,23H,12H2 |
| InChIKey | OZSFNXMZPQCUHG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|