C13H8ClF4NO2S — CID 4994625
N-[(2-chloro-3,6-difluorophenyl)methyl]-2,4-difluorobenzenesulfonamide (PubChem CID 4994625) has the molecular formula C13H8ClF4NO2S and a molecular weight of 353.72 g/mol. Its IUPAC name is N-[(2-chloro-3,6-difluorophenyl)methyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[(2-chloro-3,6-difluorophenyl)methyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 4994625 |
| Molecular Formula | C13H8ClF4NO2S |
| Molecular Weight | 353.72 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-[(2-chloro-3,6-difluorophenyl)methyl]-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1c(F)ccc(F)c1Cl)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H8ClF4NO2S/c14-13-8(9(16)2-3-10(13)17)6-19-22(20,21)12-4-1-7(15)5-11(12)18/h1-5,19H,6H2 |
| InChIKey | ZEQJPBFHVXOECY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|