C15H19N3O5S2 — CID 108789115
2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 108789115) has the molecular formula C15H19N3O5S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 108789115 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(Cc1csc(NS(=O)(=O)c2ccccc2)n1)NCCOCCO |
| InChI | InChI=1S/C15H19N3O5S2/c19-7-9-23-8-6-16-14(20)10-12-11-24-15(17-12)18-25(21,22)13-4-2-1-3-5-13/h1-5,11,19H,6-10H2,(H,16,20)(H,17,18) |
| InChIKey | DDTCZVAHGJGTRQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|