C15H17N3O5S2 — CID 108802089
ethyl 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]acetate (PubChem CID 108802089) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 108802089 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | ethyl 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)Cc1csc(NS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H17N3O5S2/c1-2-23-14(20)9-16-13(19)8-11-10-24-15(17-11)18-25(21,22)12-6-4-3-5-7-12/h3-7,10H,2,8-9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | MCQNCSKEMGJWPO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |