C14H12Cl2N2O3S — CID 113001458
2-(benzenesulfonamido)-N-(2,6-dichlorophenyl)acetamide (PubChem CID 113001458) has the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.23 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 113001458 |
| Molecular Formula | C14H12Cl2N2O3S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3S/c15-11-7-4-8-12(16)14(11)18-13(19)9-17-22(20,21)10-5-2-1-3-6-10/h1-8,17H,9H2,(H,18,19) |
| InChIKey | DNIXXXBUOZIRMU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |