C17H18FNO4S2 — CID 56998733
methyl 2-[4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenyl]acetate (PubChem CID 56998733) has the molecular formula C17H18FNO4S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl 2-[4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenyl]acetate |
|---|---|
| PubChem CID | 56998733 |
| Molecular Formula | C17H18FNO4S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | methyl 2-[4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(C(S)CNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H18FNO4S2/c1-23-17(20)10-12-2-4-13(5-3-12)16(24)11-19-25(21,22)15-8-6-14(18)7-9-15/h2-9,16,19,24H,10-11H2,1H3 |
| InChIKey | RLAZNORQGWKTBS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|