C15H23NO4S — CID 115625364
methyl 2-[4-(3,3-dimethylbutylsulfamoyl)phenyl]acetate (PubChem CID 115625364) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is methyl 2-[4-(3,3-dimethylbutylsulfamoyl)phenyl]acetate.
| Compound Name | methyl 2-[4-(3,3-dimethylbutylsulfamoyl)phenyl]acetate |
|---|---|
| PubChem CID | 115625364 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 2-[4-(3,3-dimethylbutylsulfamoyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(S(=O)(=O)NCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-15(2,3)9-10-16-21(18,19)13-7-5-12(6-8-13)11-14(17)20-4/h5-8,16H,9-11H2,1-4H3 |
| InChIKey | WUSUWLUTBSTFMA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |