C14H17NO4S — CID 106898614
methyl 2-[4-(pent-1-yn-3-ylsulfamoyl)phenyl]acetate (PubChem CID 106898614) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl 2-[4-(pent-1-yn-3-ylsulfamoyl)phenyl]acetate.
| Compound Name | methyl 2-[4-(pent-1-yn-3-ylsulfamoyl)phenyl]acetate |
|---|---|
| PubChem CID | 106898614 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl 2-[4-(pent-1-yn-3-ylsulfamoyl)phenyl]acetate |
| SMILES | C#CC(CC)NS(=O)(=O)c1ccc(CC(=O)OC)cc1 |
| InChI | InChI=1S/C14H17NO4S/c1-4-12(5-2)15-20(17,18)13-8-6-11(7-9-13)10-14(16)19-3/h1,6-9,12,15H,5,10H2,2-3H3 |
| InChIKey | NYJNKQWCERMCOA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|