C8H11N3O2S — CID 106898738
N-pent-1-yn-3-yl-1H-pyrazole-4-sulfonamide (PubChem CID 106898738) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-pent-1-yn-3-yl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106898738 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-pent-1-yn-3-yl-1H-pyrazole-4-sulfonamide |
| SMILES | C#CC(CC)NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H11N3O2S/c1-3-7(4-2)11-14(12,13)8-5-9-10-6-8/h1,5-7,11H,4H2,2H3,(H,9,10) |
| InChIKey | SVYWZSWDOMALPV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|