C8H15N3O2S2 — CID 115899543
N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 115899543) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115899543 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-3-7(6-14-2)11-15(12,13)8-4-9-10-5-8/h4-5,7,11H,3,6H2,1-2H3,(H,9,10) |
| InChIKey | OLTCIODHMUFUGQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |