C9H18N4O2S2 — CID 114142292
4-(aminomethyl)-N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 114142292) has the molecular formula C9H18N4O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114142292 |
| Molecular Formula | C9H18N4O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-(aminomethyl)-N-(1-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1[nH]ncc1CN |
| InChI | InChI=1S/C9H18N4O2S2/c1-3-8(6-16-2)13-17(14,15)9-7(4-10)5-11-12-9/h5,8,13H,3-4,6,10H2,1-2H3,(H,11,12) |
| InChIKey | KDPVGTPQYAOIGC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |