C11H12F2N4O2S2 — CID 106057867
4-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide (PubChem CID 106057867) has the molecular formula C11H12F2N4O2S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106057867 |
| Molecular Formula | C11H12F2N4O2S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]-1H-pyrazole-5-sulfonamide |
| SMILES | NCc1cn[nH]c1S(=O)(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C11H12F2N4O2S2/c12-11(13)20-9-4-2-1-3-8(9)17-21(18,19)10-7(5-14)6-15-16-10/h1-4,6,11,17H,5,14H2,(H,15,16) |
| InChIKey | ILDADQCGFVYYAS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |