C10H9BrCl2N4O2S — CID 106088231
4-(aminomethyl)-N-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106088231) has the molecular formula C10H9BrCl2N4O2S and a molecular weight of 400.09 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106088231 |
| Molecular Formula | C10H9BrCl2N4O2S |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 397.90 |
| IUPAC Name | 4-(aminomethyl)-N-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | NCc1cn[nH]c1S(=O)(=O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C10H9BrCl2N4O2S/c11-6-1-2-7(9(13)8(6)12)17-20(18,19)10-5(3-14)4-15-16-10/h1-2,4,17H,3,14H2,(H,15,16) |
| InChIKey | TXKUZCLBFWMAOQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|