C11H11F2N3O2S2 — CID 63000019
N-[2-(difluoromethylsulfanyl)phenyl]-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 63000019) has the molecular formula C11H11F2N3O2S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 63000019 |
| Molecular Formula | C11H11F2N3O2S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccccc2SC(F)F)[nH]1 |
| InChI | InChI=1S/C11H11F2N3O2S2/c1-7-14-6-10(15-7)20(17,18)16-8-4-2-3-5-9(8)19-11(12)13/h2-6,11,16H,1H3,(H,14,15) |
| InChIKey | QMWPHUDVKCXAAC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |