C10H8F3N3O2S — CID 3240350
N-[4-(trifluoromethyl)phenyl]-1H-imidazole-5-sulfonamide (PubChem CID 3240350) has the molecular formula C10H8F3N3O2S and a molecular weight of 291.25 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)phenyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[4-(trifluoromethyl)phenyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 3240350 |
| Molecular Formula | C10H8F3N3O2S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-[4-(trifluoromethyl)phenyl]-1H-imidazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C(F)(F)F)cc1)c1cnc[nH]1 |
| InChI | InChI=1S/C10H8F3N3O2S/c11-10(12,13)7-1-3-8(4-2-7)16-19(17,18)9-5-14-6-15-9/h1-6,16H,(H,14,15) |
| InChIKey | RSKODTPHNQLTPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |