C13H16N4O3S — CID 3238708
2-[1H-imidazol-5-ylsulfonyl(methyl)amino]-N-(3-methylphenyl)acetamide (PubChem CID 3238708) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[1H-imidazol-5-ylsulfonyl(methyl)amino]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[1H-imidazol-5-ylsulfonyl(methyl)amino]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3238708 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[1H-imidazol-5-ylsulfonyl(methyl)amino]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN(C)S(=O)(=O)c2cnc[nH]2)c1 |
| InChI | InChI=1S/C13H16N4O3S/c1-10-4-3-5-11(6-10)16-12(18)8-17(2)21(19,20)13-7-14-9-15-13/h3-7,9H,8H2,1-2H3,(H,14,15)(H,16,18) |
| InChIKey | GWLBBRRGBHUZDS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |