C11H11N3O2S — CID 3238261
1-(1H-imidazol-5-ylsulfonyl)-2,3-dihydroindole (PubChem CID 3238261) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylsulfonyl)-2,3-dihydroindole.
| Compound Name | 1-(1H-imidazol-5-ylsulfonyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 3238261 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-(1H-imidazol-5-ylsulfonyl)-2,3-dihydroindole |
| SMILES | O=S(=O)(c1cnc[nH]1)N1CCc2ccccc21 |
| InChI | InChI=1S/C11H11N3O2S/c15-17(16,11-7-12-8-13-11)14-6-5-9-3-1-2-4-10(9)14/h1-4,7-8H,5-6H2,(H,12,13) |
| InChIKey | DMXKEAYPZQASHQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |