C13H18N4O3S — CID 106070637
4-(aminomethyl)-N-[1-(4-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 106070637) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-(4-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-[1-(4-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106070637 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-(aminomethyl)-N-[1-(4-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2[nH]ncc2CN)cc1 |
| InChI | InChI=1S/C13H18N4O3S/c1-9(10-3-5-12(20-2)6-4-10)17-21(18,19)13-11(7-14)8-15-16-13/h3-6,8-9,17H,7,14H2,1-2H3,(H,15,16) |
| InChIKey | NXISZDKTXZUFCP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |