C11H11F2NO2S — CID 106898664
3,4-difluoro-N-pent-1-yn-3-ylbenzenesulfonamide (PubChem CID 106898664) has the molecular formula C11H11F2NO2S and a molecular weight of 259.28 g/mol. Its IUPAC name is 3,4-difluoro-N-pent-1-yn-3-ylbenzenesulfonamide.
| Compound Name | 3,4-difluoro-N-pent-1-yn-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106898664 |
| Molecular Formula | C11H11F2NO2S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3,4-difluoro-N-pent-1-yn-3-ylbenzenesulfonamide |
| SMILES | C#CC(CC)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO2S/c1-3-8(4-2)14-17(15,16)9-5-6-10(12)11(13)7-9/h1,5-8,14H,4H2,2H3 |
| InChIKey | OFMGWQKSIBAXIV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|