C12H18F2N2O2S — CID 106357386
N-(1-amino-4-methylpentan-3-yl)-3,4-difluorobenzenesulfonamide (PubChem CID 106357386) has the molecular formula C12H18F2N2O2S and a molecular weight of 292.35 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-3-yl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-3-yl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106357386 |
| Molecular Formula | C12H18F2N2O2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(1-amino-4-methylpentan-3-yl)-3,4-difluorobenzenesulfonamide |
| SMILES | CC(C)C(CCN)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H18F2N2O2S/c1-8(2)12(5-6-15)16-19(17,18)9-3-4-10(13)11(14)7-9/h3-4,7-8,12,16H,5-6,15H2,1-2H3 |
| InChIKey | CWSPOASBNPLKQI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |