C14H19FN4O2S — CID 129417000
4-fluoro-3-methyl-N-[(2R)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide (PubChem CID 129417000) has the molecular formula C14H19FN4O2S and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[(2R)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[(2R)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 129417000 |
| Molecular Formula | C14H19FN4O2S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-fluoro-3-methyl-N-[(2R)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H](Cn2nccn2)C(C)C)ccc1F |
| InChI | InChI=1S/C14H19FN4O2S/c1-10(2)14(9-19-16-6-7-17-19)18-22(20,21)12-4-5-13(15)11(3)8-12/h4-8,10,14,18H,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | KFMSCFWBPHJUJX-AWEZNQCLSA-N |
| XLogP | 1.73 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |