C19H21FN4O2S — CID 121177007
4-(4-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide (PubChem CID 121177007) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | 4-(4-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 121177007 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide |
| SMILES | CC(C)C(Cn1nccn1)NS(=O)(=O)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN4O2S/c1-14(2)19(13-24-21-11-12-22-24)23-27(25,26)18-9-5-16(6-10-18)15-3-7-17(20)8-4-15/h3-12,14,19,23H,13H2,1-2H3 |
| InChIKey | FMYIUHJCWLPNJG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |